About [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane
[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane (PubChem CID 90173471) has the molecular formula C20H22F6OSi
and a molecular weight of 420.47 g/mol. Its IUPAC name is [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane.
Molecular Properties
| Compound Name | [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane |
| PubChem CID | 90173471 |
| Molecular Formula | C20H22F6OSi |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane |
| SMILES | CC(C)[Si](O)(c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)C(C)C |
| InChI | InChI=1S/C20H22F6OSi/c1-12(2)28(27,13(3)4)18-7-5-14(6-8-18)15-9-16(19(21,22)23)11-17(10-15)20(24,25)26/h5-13,27H,1-4H3 |
| InChIKey | KEJOQOOPXPYPAZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane?
The IUPAC name of [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane (CID 90173471) is [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane.
What is the SMILES notation for [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane?
The canonical SMILES for [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane is CC(C)[Si](O)(c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1)C(C)C.
What is the InChIKey of [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane?
The InChIKey is KEJOQOOPXPYPAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F6OSi/c1-12(2)28(27,13(3)4)18-7-5-14(6-8-18)15-9-16(19(21,22)23)11-17(10-15)20(24,25)26/h5-13,27H,1-4H3.
What are the key properties of [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane?
[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane has a molecular weight of 420.47 g/mol, XLogP of 6.36, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-hydroxy-di(propan-2-yl)silane is sourced from PubChem (CID 90173471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).