C12H14F5NO5Si — CID 90173744
(2,3,4,5,6-pentafluorophenyl) N-[[diethoxy(hydroxy)silyl]methyl]carbamate (PubChem CID 90173744) has the molecular formula C12H14F5NO5Si and a molecular weight of 375.32 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) N-[[diethoxy(hydroxy)silyl]methyl]carbamate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) N-[[diethoxy(hydroxy)silyl]methyl]carbamate |
|---|---|
| PubChem CID | 90173744 |
| Molecular Formula | C12H14F5NO5Si |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) N-[[diethoxy(hydroxy)silyl]methyl]carbamate |
| SMILES | CCO[Si](O)(CNC(=O)Oc1c(F)c(F)c(F)c(F)c1F)OCC |
| InChI | InChI=1S/C12H14F5NO5Si/c1-3-21-24(20,22-4-2)5-18-12(19)23-11-9(16)7(14)6(13)8(15)10(11)17/h20H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | INOOTHCCPIMHSK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|