C10H11F5N2O4Si — CID 90174161
1-(2,3,4,5,6-pentafluorophenyl)-1-(3-trihydroxysilylpropyl)urea (PubChem CID 90174161) has the molecular formula C10H11F5N2O4Si and a molecular weight of 346.28 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-1-(3-trihydroxysilylpropyl)urea.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-1-(3-trihydroxysilylpropyl)urea |
|---|---|
| PubChem CID | 90174161 |
| Molecular Formula | C10H11F5N2O4Si |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-1-(3-trihydroxysilylpropyl)urea |
| SMILES | NC(=O)N(CCC[Si](O)(O)O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H11F5N2O4Si/c11-4-5(12)7(14)9(8(15)6(4)13)17(10(16)18)2-1-3-22(19,20)21/h19-21H,1-3H2,(H2,16,18) |
| InChIKey | ZZWHYULQMKOFHP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|