C21H19NO8 — CID 90174618
[(3R,3aS,5R,6aR)-5-(4-nitrophenoxy)carbonyloxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl] benzoate (PubChem CID 90174618) has the molecular formula C21H19NO8 and a molecular weight of 413.38 g/mol. Its IUPAC name is [(3R,3aS,5R,6aR)-5-(4-nitrophenoxy)carbonyloxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl] benzoate.
| Compound Name | [(3R,3aS,5R,6aR)-5-(4-nitrophenoxy)carbonyloxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl] benzoate |
|---|---|
| PubChem CID | 90174618 |
| Molecular Formula | C21H19NO8 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [(3R,3aS,5R,6aR)-5-(4-nitrophenoxy)carbonyloxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl] benzoate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)O[C@@H]1C[C@@H]2[C@@H](OC(=O)c3ccccc3)CO[C@@H]2C1 |
| InChI | InChI=1S/C21H19NO8/c23-20(13-4-2-1-3-5-13)30-19-12-27-18-11-16(10-17(18)19)29-21(24)28-15-8-6-14(7-9-15)22(25)26/h1-9,16-19H,10-12H2/t16-,17+,18-,19+/m1/s1 |
| InChIKey | SRMFPPQMHDDXCL-HCXYKTFWSA-N |
| XLogP | 3.51 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|