About ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane
ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane (PubChem CID 90174756) has the molecular formula C16H25F3O2Si
and a molecular weight of 334.45 g/mol. Its IUPAC name is ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane.
Molecular Properties
| Compound Name | ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane |
| PubChem CID | 90174756 |
| Molecular Formula | C16H25F3O2Si |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane |
| SMILES | CC[Si](CCCCCCc1c(F)cc(F)cc1F)(OC)OC |
| InChI | InChI=1S/C16H25F3O2Si/c1-4-22(20-2,21-3)10-8-6-5-7-9-14-15(18)11-13(17)12-16(14)19/h11-12H,4-10H2,1-3H3 |
| InChIKey | AOCMHFFNTSKFSX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
The IUPAC name of ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane (CID 90174756) is ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane.
What is the SMILES notation for ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
The canonical SMILES for ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane is CC[Si](CCCCCCc1c(F)cc(F)cc1F)(OC)OC.
What is the InChIKey of ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
The InChIKey is AOCMHFFNTSKFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25F3O2Si/c1-4-22(20-2,21-3)10-8-6-5-7-9-14-15(18)11-13(17)12-16(14)19/h11-12H,4-10H2,1-3H3.
What are the key properties of ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane?
ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane has a molecular weight of 334.45 g/mol, XLogP of 4.96, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-dimethoxy-[6-(2,4,6-trifluorophenyl)hexyl]silane is sourced from PubChem (CID 90174756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).