About 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane
6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane (PubChem CID 90174980) has the molecular formula C18H26F6OSi
and a molecular weight of 400.48 g/mol. Its IUPAC name is 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane.
Molecular Properties
| Compound Name | 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane |
| PubChem CID | 90174980 |
| Molecular Formula | C18H26F6OSi |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane |
| SMILES | CCO[Si](C)(C)CCCCCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H26F6OSi/c1-4-25-26(2,3)10-8-6-5-7-9-14-11-15(17(19,20)21)13-16(12-14)18(22,23)24/h11-13H,4-10H2,1-3H3 |
| InChIKey | OIKOVSDRSFAMFL-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane?
The IUPAC name of 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane (CID 90174980) is 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane.
What is the SMILES notation for 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane?
The canonical SMILES for 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane is CCO[Si](C)(C)CCCCCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane?
The InChIKey is OIKOVSDRSFAMFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F6OSi/c1-4-25-26(2,3)10-8-6-5-7-9-14-11-15(17(19,20)21)13-16(12-14)18(22,23)24/h11-13H,4-10H2,1-3H3.
What are the key properties of 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane?
6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane has a molecular weight of 400.48 g/mol, XLogP of 7.07, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3,5-bis(trifluoromethyl)phenyl]hexyl-ethoxy-dimethylsilane is sourced from PubChem (CID 90174980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).