C11H13F5O2Si — CID 90175042
ethoxy-dimethyl-[(2,3,4,5,6-pentafluorophenoxy)methyl]silane (PubChem CID 90175042) has the molecular formula C11H13F5O2Si and a molecular weight of 300.30 g/mol. Its IUPAC name is ethoxy-dimethyl-[(2,3,4,5,6-pentafluorophenoxy)methyl]silane.
| Compound Name | ethoxy-dimethyl-[(2,3,4,5,6-pentafluorophenoxy)methyl]silane |
|---|---|
| PubChem CID | 90175042 |
| Molecular Formula | C11H13F5O2Si |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | ethoxy-dimethyl-[(2,3,4,5,6-pentafluorophenoxy)methyl]silane |
| SMILES | CCO[Si](C)(C)COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H13F5O2Si/c1-4-18-19(2,3)5-17-11-9(15)7(13)6(12)8(14)10(11)16/h4-5H2,1-3H3 |
| InChIKey | YEOZPBDKJRQOOQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|