C12H13ClFN5O — CID 90175511
6-chloro-2-N-(4-fluorophenoxy)-4-N-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 90175511) has the molecular formula C12H13ClFN5O and a molecular weight of 297.72 g/mol. Its IUPAC name is 6-chloro-2-N-(4-fluorophenoxy)-4-N-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(4-fluorophenoxy)-4-N-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 90175511 |
| Molecular Formula | C12H13ClFN5O |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 6-chloro-2-N-(4-fluorophenoxy)-4-N-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(Cl)nc(NOc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H13ClFN5O/c1-2-7-15-11-16-10(13)17-12(18-11)19-20-9-5-3-8(14)4-6-9/h3-6H,2,7H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | NAEZHRDTMAGYOJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|