C15H17FN6O — CID 90175535
2-N-(4-fluorophenoxy)-6-N-propyl-4-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 90175535) has the molecular formula C15H17FN6O and a molecular weight of 316.34 g/mol. Its IUPAC name is 2-N-(4-fluorophenoxy)-6-N-propyl-4-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-fluorophenoxy)-6-N-propyl-4-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 90175535 |
| Molecular Formula | C15H17FN6O |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-N-(4-fluorophenoxy)-6-N-propyl-4-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | C#CCNc1nc(NCCC)nc(NOc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H17FN6O/c1-3-9-17-13-19-14(18-10-4-2)21-15(20-13)22-23-12-7-5-11(16)6-8-12/h1,5-8H,4,9-10H2,2H3,(H3,17,18,19,20,21,22) |
| InChIKey | AXJDEWXCRGTGQY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|