C9H12ClN5 — CID 90175549
6-chloro-2-N-[(2E)-2-methylpenta-2,4-dienyl]-1,3,5-triazine-2,4-diamine (PubChem CID 90175549) has the molecular formula C9H12ClN5 and a molecular weight of 225.68 g/mol. Its IUPAC name is 6-chloro-2-N-[(2E)-2-methylpenta-2,4-dienyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-[(2E)-2-methylpenta-2,4-dienyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 90175549 |
| Molecular Formula | C9H12ClN5 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 6-chloro-2-N-[(2E)-2-methylpenta-2,4-dienyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=C/C=C(\C)CNc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C9H12ClN5/c1-3-4-6(2)5-12-9-14-7(10)13-8(11)15-9/h3-4H,1,5H2,2H3,(H3,11,12,13,14,15)/b6-4+ |
| InChIKey | VTCHJYMZHOTOLR-GQCTYLIASA-N |
| XLogP | 1.65 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|