About tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate
tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate (PubChem CID 90175920) has the molecular formula C21H20BrN5O3
and a molecular weight of 470.33 g/mol. Its IUPAC name is tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate |
| PubChem CID | 90175920 |
| Molecular Formula | C21H20BrN5O3 |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)N(C(=O)c1ccn2ncc(Br)c2c1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H20BrN5O3/c1-21(2,3)30-20(29)25(4)27(16-7-5-14(12-23)6-8-16)19(28)15-9-10-26-18(11-15)17(22)13-24-26/h5-11,13H,1-4H3 |
| InChIKey | IFHCXBNNYRBIMX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 90.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate?
The IUPAC name of tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate (CID 90175920) is tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate?
The canonical SMILES for tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate is CN(C(=O)OC(C)(C)C)N(C(=O)c1ccn2ncc(Br)c2c1)c1ccc(C#N)cc1.
What is the InChIKey of tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate?
The InChIKey is IFHCXBNNYRBIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20BrN5O3/c1-21(2,3)30-20(29)25(4)27(16-7-5-14(12-23)6-8-16)19(28)15-9-10-26-18(11-15)17(22)13-24-26/h5-11,13H,1-4H3.
What are the key properties of tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate?
tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate has a molecular weight of 470.33 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(N-(3-bromopyrazolo[1,5-a]pyridine-5-carbonyl)-4-cyanoanilino)-N-methylcarbamate is sourced from PubChem (CID 90175920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).