C24H24N6O3 — CID 90176089
N-cyclopropyl-4-[4-(2-methoxyethylamino)-2-phenoxypyrazolo[1,5-a][1,3,5]triazin-8-yl]benzamide (PubChem CID 90176089) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is N-cyclopropyl-4-[4-(2-methoxyethylamino)-2-phenoxypyrazolo[1,5-a][1,3,5]triazin-8-yl]benzamide.
| Compound Name | N-cyclopropyl-4-[4-(2-methoxyethylamino)-2-phenoxypyrazolo[1,5-a][1,3,5]triazin-8-yl]benzamide |
|---|---|
| PubChem CID | 90176089 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-cyclopropyl-4-[4-(2-methoxyethylamino)-2-phenoxypyrazolo[1,5-a][1,3,5]triazin-8-yl]benzamide |
| SMILES | COCCNc1nc(Oc2ccccc2)nc2c(-c3ccc(C(=O)NC4CC4)cc3)cnn12 |
| InChI | InChI=1S/C24H24N6O3/c1-32-14-13-25-23-29-24(33-19-5-3-2-4-6-19)28-21-20(15-26-30(21)23)16-7-9-17(10-8-16)22(31)27-18-11-12-18/h2-10,15,18H,11-14H2,1H3,(H,27,31)(H,25,28,29) |
| InChIKey | WAVXESKOKZLPJL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|