C21H40N2O6Si — CID 90176324
tert-butyl (3aR,4R,6aS)-6-(2-amino-2-oxoethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 90176324) has the molecular formula C21H40N2O6Si and a molecular weight of 444.65 g/mol. Its IUPAC name is tert-butyl (3aR,4R,6aS)-6-(2-amino-2-oxoethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,4R,6aS)-6-(2-amino-2-oxoethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 90176324 |
| Molecular Formula | C21H40N2O6Si |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | tert-butyl (3aR,4R,6aS)-6-(2-amino-2-oxoethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(CC(N)=O)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40N2O6Si/c1-19(2,3)29-18(25)23-13(11-15(22)24)16-17(28-21(7,8)27-16)14(23)12-26-30(9,10)20(4,5)6/h13-14,16-17H,11-12H2,1-10H3,(H2,22,24)/t13?,14-,16+,17-/m1/s1 |
| InChIKey | AVASRWCULSCVQV-IIYZTLLPSA-N |
| XLogP | 3.39 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|