About 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine
5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine (PubChem CID 90176477) has the molecular formula C7H9BrN2O4S
and a molecular weight of 297.13 g/mol. Its IUPAC name is 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine.
Molecular Properties
| Compound Name | 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine |
| PubChem CID | 90176477 |
| Molecular Formula | C7H9BrN2O4S |
| Molecular Weight | 297.13 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine |
| SMILES | COc1nc(S(C)(=O)=O)nc(OC)c1Br |
| InChI | InChI=1S/C7H9BrN2O4S/c1-13-5-4(8)6(14-2)10-7(9-5)15(3,11)12/h1-3H3 |
| InChIKey | HMJOJIFTPCMMAN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.13 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine?
The IUPAC name of 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine (CID 90176477) is 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine.
What is the SMILES notation for 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine?
The canonical SMILES for 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine is COc1nc(S(C)(=O)=O)nc(OC)c1Br.
What is the InChIKey of 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine?
The InChIKey is HMJOJIFTPCMMAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2O4S/c1-13-5-4(8)6(14-2)10-7(9-5)15(3,11)12/h1-3H3.
What are the key properties of 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine?
5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine has a molecular weight of 297.13 g/mol, XLogP of 0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4,6-dimethoxy-2-methylsulfonylpyrimidine is sourced from PubChem (CID 90176477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).