About 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one
1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one (PubChem CID 90176647) has the molecular formula C11H20FNO
and a molecular weight of 201.28 g/mol. Its IUPAC name is 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one.
Molecular Properties
| Compound Name | 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one |
| PubChem CID | 90176647 |
| Molecular Formula | C11H20FNO |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one |
| SMILES | CC1(C)CN(C(C)(C)C)CC(F)C1=O |
| InChI | InChI=1S/C11H20FNO/c1-10(2,3)13-6-8(12)9(14)11(4,5)7-13/h8H,6-7H2,1-5H3 |
| InChIKey | IGGVNYXYLHHDJN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one?
The IUPAC name of 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one (CID 90176647) is 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one.
What is the SMILES notation for 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one?
The canonical SMILES for 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one is CC1(C)CN(C(C)(C)C)CC(F)C1=O.
What is the InChIKey of 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one?
The InChIKey is IGGVNYXYLHHDJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20FNO/c1-10(2,3)13-6-8(12)9(14)11(4,5)7-13/h8H,6-7H2,1-5H3.
What are the key properties of 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one?
1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one has a molecular weight of 201.28 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5-fluoro-3,3-dimethylpiperidin-4-one is sourced from PubChem (CID 90176647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).