C13H22FNO3 — CID 90176680
tert-butyl 6-fluoro-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 90176680) has the molecular formula C13H22FNO3 and a molecular weight of 259.32 g/mol. Its IUPAC name is tert-butyl 6-fluoro-1-oxa-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 6-fluoro-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 90176680 |
| Molecular Formula | C13H22FNO3 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | tert-butyl 6-fluoro-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCO2)C(F)C1 |
| InChI | InChI=1S/C13H22FNO3/c1-12(2,3)18-11(16)15-7-6-13(10(14)9-15)5-4-8-17-13/h10H,4-9H2,1-3H3 |
| InChIKey | BAJQEMLFTSRFHE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |