C6H13ClFNO — CID 90176861
(3S,4R)-3-fluoro-4-methoxypiperidine;hydrochloride (PubChem CID 90176861) has the molecular formula C6H13ClFNO and a molecular weight of 169.63 g/mol. Its IUPAC name is (3S,4R)-3-fluoro-4-methoxypiperidine;hydrochloride.
| Compound Name | (3S,4R)-3-fluoro-4-methoxypiperidine;hydrochloride |
|---|---|
| PubChem CID | 90176861 |
| Molecular Formula | C6H13ClFNO |
| Molecular Weight | 169.63 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (3S,4R)-3-fluoro-4-methoxypiperidine;hydrochloride |
| SMILES | CO[C@@H]1CCNC[C@@H]1F.Cl |
| InChI | InChI=1S/C6H12FNO.ClH/c1-9-6-2-3-8-4-5(6)7;/h5-6,8H,2-4H2,1H3;1H/t5-,6+;/m0./s1 |
| InChIKey | RXBHOPYLIYPIMX-RIHPBJNCSA-N |
| XLogP | 0.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.63 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |