C30H22BrN3 — CID 90177102
2-(7-bromo-9,9-dimethylfluoren-2-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 90177102) has the molecular formula C30H22BrN3 and a molecular weight of 504.43 g/mol. Its IUPAC name is 2-(7-bromo-9,9-dimethylfluoren-2-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(7-bromo-9,9-dimethylfluoren-2-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 90177102 |
| Molecular Formula | C30H22BrN3 |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 2-(7-bromo-9,9-dimethylfluoren-2-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2cc(Br)ccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C30H22BrN3/c1-30(2)25-17-21(13-15-23(25)24-16-14-22(31)18-26(24)30)29-33-27(19-9-5-3-6-10-19)32-28(34-29)20-11-7-4-8-12-20/h3-18H,1-2H3 |
| InChIKey | JVCGRNFVJXKFRR-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |