C15H17ClF3N3O2 — CID 90177588
6-chloro-2-(oxan-2-yloxymethyl)-1-[(2R)-1,1,1-trifluoropropan-2-yl]imidazo[4,5-c]pyridine (PubChem CID 90177588) has the molecular formula C15H17ClF3N3O2 and a molecular weight of 363.77 g/mol. Its IUPAC name is 6-chloro-2-(oxan-2-yloxymethyl)-1-[(2R)-1,1,1-trifluoropropan-2-yl]imidazo[4,5-c]pyridine.
| Compound Name | 6-chloro-2-(oxan-2-yloxymethyl)-1-[(2R)-1,1,1-trifluoropropan-2-yl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 90177588 |
| Molecular Formula | C15H17ClF3N3O2 |
| Molecular Weight | 363.77 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 6-chloro-2-(oxan-2-yloxymethyl)-1-[(2R)-1,1,1-trifluoropropan-2-yl]imidazo[4,5-c]pyridine |
| SMILES | C[C@@H](n1c(COC2CCCCO2)nc2cnc(Cl)cc21)C(F)(F)F |
| InChI | InChI=1S/C15H17ClF3N3O2/c1-9(15(17,18)19)22-11-6-12(16)20-7-10(11)21-13(22)8-24-14-4-2-3-5-23-14/h6-7,9,14H,2-5,8H2,1H3/t9-,14?/m1/s1 |
| InChIKey | QVHVHQHNOXNUEW-UCWRFOARSA-N |
| XLogP | 4.25 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|