C21H36N4O3 — CID 90177845
3-[3-ethyl-4-(6-octoxypyridazin-3-yl)piperazin-1-yl]propanoic acid (PubChem CID 90177845) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is 3-[3-ethyl-4-(6-octoxypyridazin-3-yl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-[3-ethyl-4-(6-octoxypyridazin-3-yl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 90177845 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 3-[3-ethyl-4-(6-octoxypyridazin-3-yl)piperazin-1-yl]propanoic acid |
| SMILES | CCCCCCCCOc1ccc(N2CCN(CCC(=O)O)CC2CC)nn1 |
| InChI | InChI=1S/C21H36N4O3/c1-3-5-6-7-8-9-16-28-20-11-10-19(22-23-20)25-15-14-24(13-12-21(26)27)17-18(25)4-2/h10-11,18H,3-9,12-17H2,1-2H3,(H,26,27) |
| InChIKey | PMIFTFPQYCTDDX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|