About methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate
methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate (PubChem CID 901779) has the molecular formula C8H9N3O5
and a molecular weight of 227.18 g/mol. Its IUPAC name is methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate.
Molecular Properties
| Compound Name | methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate |
| PubChem CID | 901779 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate |
| SMILES | COC(=O)NC(=O)c1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9N3O5/c1-11-3-4(5(12)9-7(11)14)6(13)10-8(15)16-2/h3H,1-2H3,(H,9,12,14)(H,10,13,15) |
| InChIKey | QUIOEEJYIDFLIS-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate?
The IUPAC name of methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate (CID 901779) is methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate.
What is the SMILES notation for methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate?
The canonical SMILES for methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate is COC(=O)NC(=O)c1cn(C)c(=O)[nH]c1=O.
What is the InChIKey of methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate?
The InChIKey is QUIOEEJYIDFLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O5/c1-11-3-4(5(12)9-7(11)14)6(13)10-8(15)16-2/h3H,1-2H3,(H,9,12,14)(H,10,13,15).
What are the key properties of methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate?
methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate has a molecular weight of 227.18 g/mol, XLogP of -1.43, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(1-methyl-2,4-dioxopyrimidine-5-carbonyl)carbamate is sourced from PubChem (CID 901779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).