C13H11N3O2S — CID 90177935
1H-benzimidazol-2-ylsulfinyl(pyridin-2-yl)methanol (PubChem CID 90177935) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is 1H-benzimidazol-2-ylsulfinyl(pyridin-2-yl)methanol.
| Compound Name | 1H-benzimidazol-2-ylsulfinyl(pyridin-2-yl)methanol |
|---|---|
| PubChem CID | 90177935 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1H-benzimidazol-2-ylsulfinyl(pyridin-2-yl)methanol |
| SMILES | O=S(c1nc2ccccc2[nH]1)C(O)c1ccccn1 |
| InChI | InChI=1S/C13H11N3O2S/c17-12(11-7-3-4-8-14-11)19(18)13-15-9-5-1-2-6-10(9)16-13/h1-8,12,17H,(H,15,16) |
| InChIKey | MSFVWHRHEAAUHS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |