C20H22N4O3 — CID 90178158
2-(3-methoxy-N-methylanilino)-N-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]acetamide (PubChem CID 90178158) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-(3-methoxy-N-methylanilino)-N-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]acetamide.
| Compound Name | 2-(3-methoxy-N-methylanilino)-N-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 90178158 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-(3-methoxy-N-methylanilino)-N-[3-methoxy-4-(1H-pyrazol-4-yl)phenyl]acetamide |
| SMILES | COc1cccc(N(C)CC(=O)Nc2ccc(-c3cn[nH]c3)c(OC)c2)c1 |
| InChI | InChI=1S/C20H22N4O3/c1-24(16-5-4-6-17(10-16)26-2)13-20(25)23-15-7-8-18(19(9-15)27-3)14-11-21-22-12-14/h4-12H,13H2,1-3H3,(H,21,22)(H,23,25) |
| InChIKey | WEKVHLQCOWMTOC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |