C11H11ClF3N3O — CID 90178294
(1R)-1-[6-chloro-1-[(2R)-1,1,1-trifluoropropan-2-yl]imidazo[4,5-c]pyridin-2-yl]ethanol (PubChem CID 90178294) has the molecular formula C11H11ClF3N3O and a molecular weight of 293.68 g/mol. Its IUPAC name is (1R)-1-[6-chloro-1-[(2R)-1,1,1-trifluoropropan-2-yl]imidazo[4,5-c]pyridin-2-yl]ethanol.
| Compound Name | (1R)-1-[6-chloro-1-[(2R)-1,1,1-trifluoropropan-2-yl]imidazo[4,5-c]pyridin-2-yl]ethanol |
|---|---|
| PubChem CID | 90178294 |
| Molecular Formula | C11H11ClF3N3O |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | (1R)-1-[6-chloro-1-[(2R)-1,1,1-trifluoropropan-2-yl]imidazo[4,5-c]pyridin-2-yl]ethanol |
| SMILES | C[C@@H](O)c1nc2cnc(Cl)cc2n1[C@H](C)C(F)(F)F |
| InChI | InChI=1S/C11H11ClF3N3O/c1-5(19)10-17-7-4-16-9(12)3-8(7)18(10)6(2)11(13,14)15/h3-6,19H,1-2H3/t5-,6-/m1/s1 |
| InChIKey | JVDQBZKBVBIRIO-PHDIDXHHSA-N |
| XLogP | 3.26 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|