About (1S)-1,2-bis(bromomethyl)cyclopropane
(1S)-1,2-bis(bromomethyl)cyclopropane (PubChem CID 90178479) has the molecular formula C5H8Br2
and a molecular weight of 227.93 g/mol. Its IUPAC name is (1S)-1,2-bis(bromomethyl)cyclopropane.
Molecular Properties
| Compound Name | (1S)-1,2-bis(bromomethyl)cyclopropane |
| PubChem CID | 90178479 |
| Molecular Formula | C5H8Br2 |
| Molecular Weight | 227.93 g/mol |
| Exact Mass | 225.90 |
| IUPAC Name | (1S)-1,2-bis(bromomethyl)cyclopropane |
| SMILES | BrCC1C[C@@H]1CBr |
| InChI | InChI=1S/C5H8Br2/c6-2-4-1-5(4)3-7/h4-5H,1-3H2/t4-,5?/m1/s1 |
| InChIKey | BYTFOVGHZSNHNT-CNZKWPKMSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.93 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1,2-bis(bromomethyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1,2-bis(bromomethyl)cyclopropane?
The IUPAC name of (1S)-1,2-bis(bromomethyl)cyclopropane (CID 90178479) is (1S)-1,2-bis(bromomethyl)cyclopropane.
What is the SMILES notation for (1S)-1,2-bis(bromomethyl)cyclopropane?
The canonical SMILES for (1S)-1,2-bis(bromomethyl)cyclopropane is BrCC1C[C@@H]1CBr.
What is the InChIKey of (1S)-1,2-bis(bromomethyl)cyclopropane?
The InChIKey is BYTFOVGHZSNHNT-CNZKWPKMSA-N. The full InChI is InChI=1S/C5H8Br2/c6-2-4-1-5(4)3-7/h4-5H,1-3H2/t4-,5?/m1/s1.
What are the key properties of (1S)-1,2-bis(bromomethyl)cyclopropane?
(1S)-1,2-bis(bromomethyl)cyclopropane has a molecular weight of 227.93 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1,2-bis(bromomethyl)cyclopropane is sourced from PubChem (CID 90178479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).