About 5-iodothieno[2,3-d]pyrimidin-4-amine
5-iodothieno[2,3-d]pyrimidin-4-amine (PubChem CID 90178606) has the molecular formula C6H4IN3S
and a molecular weight of 277.09 g/mol. Its IUPAC name is 5-iodothieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-iodothieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 90178606 |
| Molecular Formula | C6H4IN3S |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 276.92 |
| IUPAC Name | 5-iodothieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2scc(I)c12 |
| InChI | InChI=1S/C6H4IN3S/c7-3-1-11-6-4(3)5(8)9-2-10-6/h1-2H,(H2,8,9,10) |
| InChIKey | NMNCJCAESWBWIY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodothieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodothieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5-iodothieno[2,3-d]pyrimidin-4-amine (CID 90178606) is 5-iodothieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5-iodothieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5-iodothieno[2,3-d]pyrimidin-4-amine is Nc1ncnc2scc(I)c12.
What is the InChIKey of 5-iodothieno[2,3-d]pyrimidin-4-amine?
The InChIKey is NMNCJCAESWBWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4IN3S/c7-3-1-11-6-4(3)5(8)9-2-10-6/h1-2H,(H2,8,9,10).
What are the key properties of 5-iodothieno[2,3-d]pyrimidin-4-amine?
5-iodothieno[2,3-d]pyrimidin-4-amine has a molecular weight of 277.09 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodothieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 90178606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).