C15H20N2O10P2 — CID 90178635
[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl-hydroxyphosphoryl]ethyl]phosphinic acid (PubChem CID 90178635) has the molecular formula C15H20N2O10P2 and a molecular weight of 450.28 g/mol. Its IUPAC name is [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl-hydroxyphosphoryl]ethyl]phosphinic acid.
| Compound Name | [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl-hydroxyphosphoryl]ethyl]phosphinic acid |
|---|---|
| PubChem CID | 90178635 |
| Molecular Formula | C15H20N2O10P2 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | [3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl-hydroxyphosphoryl]ethyl]phosphinic acid |
| SMILES | O=C(CCP(=O)(O)CCP(=O)(O)CCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H20N2O10P2/c18-11-1-2-12(19)16(11)6-8-29(25,26)10-9-28(23,24)7-5-15(22)27-17-13(20)3-4-14(17)21/h1-2H,3-10H2,(H,23,24)(H,25,26) |
| InChIKey | RTLRCFZDEQWNAI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 175.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|