About 3-methyl-7aH-indazole
3-methyl-7aH-indazole (PubChem CID 90179179) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 3-methyl-7aH-indazole.
Molecular Properties
| Compound Name | 3-methyl-7aH-indazole |
| PubChem CID | 90179179 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 3-methyl-7aH-indazole |
| SMILES | CC1=C2C=CC=CC2N=N1 |
| InChI | InChI=1S/C8H8N2/c1-6-7-4-2-3-5-8(7)10-9-6/h2-5,8H,1H3 |
| InChIKey | SCVUTMPFOHVURP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-7aH-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7aH-indazole?
The IUPAC name of 3-methyl-7aH-indazole (CID 90179179) is 3-methyl-7aH-indazole.
What is the SMILES notation for 3-methyl-7aH-indazole?
The canonical SMILES for 3-methyl-7aH-indazole is CC1=C2C=CC=CC2N=N1.
What is the InChIKey of 3-methyl-7aH-indazole?
The InChIKey is SCVUTMPFOHVURP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-6-7-4-2-3-5-8(7)10-9-6/h2-5,8H,1H3.
What are the key properties of 3-methyl-7aH-indazole?
3-methyl-7aH-indazole has a molecular weight of 132.17 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7aH-indazole is sourced from PubChem (CID 90179179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).