C21H23Cl2N5S — CID 90179244
4-cyano-3-(2,4-dichlorophenyl)-5-[(2R,7S)-2,7-dimethylazepan-1-yl]-N'-methanimidoylthiophene-2-carboximidamide (PubChem CID 90179244) has the molecular formula C21H23Cl2N5S and a molecular weight of 448.42 g/mol. Its IUPAC name is 4-cyano-3-(2,4-dichlorophenyl)-5-[(2R,7S)-2,7-dimethylazepan-1-yl]-N'-methanimidoylthiophene-2-carboximidamide.
| Compound Name | 4-cyano-3-(2,4-dichlorophenyl)-5-[(2R,7S)-2,7-dimethylazepan-1-yl]-N'-methanimidoylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 90179244 |
| Molecular Formula | C21H23Cl2N5S |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 4-cyano-3-(2,4-dichlorophenyl)-5-[(2R,7S)-2,7-dimethylazepan-1-yl]-N'-methanimidoylthiophene-2-carboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1sc(N2[C@H](C)CCCC[C@@H]2C)c(C#N)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H23Cl2N5S/c1-12-5-3-4-6-13(2)28(12)21-16(10-24)18(19(29-21)20(26)27-11-25)15-8-7-14(22)9-17(15)23/h7-9,11-13H,3-6H2,1-2H3,(H3,25,26,27)/t12-,13+ |
| InChIKey | ZPWVWMWRCMLTFR-BETUJISGSA-N |
| XLogP | 6.06 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|