About 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine
1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine (PubChem CID 90179713) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine |
| PubChem CID | 90179713 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine |
| SMILES | [H]/N=C/C1=CCC=C1CN(C)C |
| InChI | InChI=1S/C9H14N2/c1-11(2)7-9-5-3-4-8(9)6-10/h4-6,10H,3,7H2,1-2H3/b10-6+ |
| InChIKey | HUNVEZZZVLDLSV-UXBLZVDNSA-N |
| XLogP | 1.45 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine (CID 90179713) is 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine is [H]/N=C/C1=CCC=C1CN(C)C.
What is the InChIKey of 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine?
The InChIKey is HUNVEZZZVLDLSV-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H14N2/c1-11(2)7-9-5-3-4-8(9)6-10/h4-6,10H,3,7H2,1-2H3/b10-6+.
What are the key properties of 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine?
1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine has a molecular weight of 150.22 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methanimidoylcyclopenta-1,4-dien-1-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 90179713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).