About 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane
2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane (PubChem CID 90180080) has the molecular formula C17H19F5O3
and a molecular weight of 366.33 g/mol. Its IUPAC name is 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane.
Molecular Properties
| Compound Name | 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
| PubChem CID | 90180080 |
| Molecular Formula | C17H19F5O3 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(c2ccc(C(F)(F)OC(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C17H19F5O3/c1-2-3-4-5-12-10-23-15(24-11-12)13-6-8-14(9-7-13)16(18,19)25-17(20,21)22/h2-3,6-9,12,15H,4-5,10-11H2,1H3/b3-2+ |
| InChIKey | JUTRXFOSXHYUTH-NSCUHMNNSA-N |
| XLogP | 5.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane?
The IUPAC name of 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane (CID 90180080) is 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane.
What is the SMILES notation for 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane?
The canonical SMILES for 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane is C/C=C/CCC1COC(c2ccc(C(F)(F)OC(F)(F)F)cc2)OC1.
What is the InChIKey of 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane?
The InChIKey is JUTRXFOSXHYUTH-NSCUHMNNSA-N. The full InChI is InChI=1S/C17H19F5O3/c1-2-3-4-5-12-10-23-15(24-11-12)13-6-8-14(9-7-13)16(18,19)25-17(20,21)22/h2-3,6-9,12,15H,4-5,10-11H2,1H3/b3-2+.
What are the key properties of 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane?
2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane has a molecular weight of 366.33 g/mol, XLogP of 5.29, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[difluoro(trifluoromethoxy)methyl]phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane is sourced from PubChem (CID 90180080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).