C7H8O2 — CID 90180471
(3aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 90180471) has the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. Its IUPAC name is (3aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 90180471 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | (3aS)-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@H]2C=CCC2O1 |
| InChI | InChI=1S/C7H8O2/c8-7-4-5-2-1-3-6(5)9-7/h1-2,5-6H,3-4H2/t5-,6?/m1/s1 |
| InChIKey | RYBPGUMSFWGGLP-LWOQYNTDSA-N |
| XLogP | 0.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|