About 5-methoxy-1,2-dimethyl-1,2,5-triazepane
5-methoxy-1,2-dimethyl-1,2,5-triazepane (PubChem CID 90180666) has the molecular formula C7H17N3O
and a molecular weight of 159.23 g/mol. Its IUPAC name is 5-methoxy-1,2-dimethyl-1,2,5-triazepane.
Molecular Properties
| Compound Name | 5-methoxy-1,2-dimethyl-1,2,5-triazepane |
| PubChem CID | 90180666 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 5-methoxy-1,2-dimethyl-1,2,5-triazepane |
| SMILES | CON1CCN(C)N(C)CC1 |
| InChI | InChI=1S/C7H17N3O/c1-8-4-6-10(11-3)7-5-9(8)2/h4-7H2,1-3H3 |
| InChIKey | WUZDKXHOEVCUFQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxy-1,2-dimethyl-1,2,5-triazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,2-dimethyl-1,2,5-triazepane?
The IUPAC name of 5-methoxy-1,2-dimethyl-1,2,5-triazepane (CID 90180666) is 5-methoxy-1,2-dimethyl-1,2,5-triazepane.
What is the SMILES notation for 5-methoxy-1,2-dimethyl-1,2,5-triazepane?
The canonical SMILES for 5-methoxy-1,2-dimethyl-1,2,5-triazepane is CON1CCN(C)N(C)CC1.
What is the InChIKey of 5-methoxy-1,2-dimethyl-1,2,5-triazepane?
The InChIKey is WUZDKXHOEVCUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3O/c1-8-4-6-10(11-3)7-5-9(8)2/h4-7H2,1-3H3.
What are the key properties of 5-methoxy-1,2-dimethyl-1,2,5-triazepane?
5-methoxy-1,2-dimethyl-1,2,5-triazepane has a molecular weight of 159.23 g/mol, XLogP of -0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,2-dimethyl-1,2,5-triazepane is sourced from PubChem (CID 90180666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).