About trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate
trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate (PubChem CID 90180893) has the molecular formula C15H29NO
and a molecular weight of 239.40 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate.
Molecular Properties
| Compound Name | trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate |
| PubChem CID | 90180893 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate |
| SMILES | [H]/N=C(\OCC)[C@H]1CCC(C(C)C)[C@]1(C)C(C)C |
| InChI | InChI=1S/C15H29NO/c1-7-17-14(16)13-9-8-12(10(2)3)15(13,6)11(4)5/h10-13,16H,7-9H2,1-6H3/b16-14-/t12?,13-,15+/m1/s1 |
| InChIKey | PJCUYMBVAQAOCV-WBYFBSQPSA-N |
| XLogP | 4.34 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate?
The IUPAC name of trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate (CID 90180893) is trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate.
What is the SMILES notation for trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate?
The canonical SMILES for trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate is [H]/N=C(\OCC)[C@H]1CCC(C(C)C)[C@]1(C)C(C)C.
What is the InChIKey of trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate?
The InChIKey is PJCUYMBVAQAOCV-WBYFBSQPSA-N. The full InChI is InChI=1S/C15H29NO/c1-7-17-14(16)13-9-8-12(10(2)3)15(13,6)11(4)5/h10-13,16H,7-9H2,1-6H3/b16-14-/t12?,13-,15+/m1/s1.
What are the key properties of trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate?
trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate has a molecular weight of 239.40 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-ethyl (1S,2S)-2-methyl-2,3-di(propan-2-yl)cyclopentane-1-carboximidate is sourced from PubChem (CID 90180893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).