C16H14F3N3 — CID 90181089
2-ethynyl-8-[2-methyl-5-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 90181089) has the molecular formula C16H14F3N3 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-ethynyl-8-[2-methyl-5-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-ethynyl-8-[2-methyl-5-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 90181089 |
| Molecular Formula | C16H14F3N3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-ethynyl-8-[2-methyl-5-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | C#Cc1nc2n(n1)CCCC2c1cc(C(F)(F)F)ccc1C |
| InChI | InChI=1S/C16H14F3N3/c1-3-14-20-15-12(5-4-8-22(15)21-14)13-9-11(16(17,18)19)7-6-10(13)2/h1,6-7,9,12H,4-5,8H2,2H3 |
| InChIKey | AFZNEYNWDIZMFZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|