C30H36FN7OSi — CID 90181098
2-[[2-[8-(4-fluoro-2-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-5-(4-methylimidazol-1-yl)pyrrolo[3,2-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 90181098) has the molecular formula C30H36FN7OSi and a molecular weight of 557.75 g/mol. Its IUPAC name is 2-[[2-[8-(4-fluoro-2-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-5-(4-methylimidazol-1-yl)pyrrolo[3,2-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[8-(4-fluoro-2-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-5-(4-methylimidazol-1-yl)pyrrolo[3,2-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 90181098 |
| Molecular Formula | C30H36FN7OSi |
| Molecular Weight | 557.75 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 2-[[2-[8-(4-fluoro-2-methylphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-5-(4-methylimidazol-1-yl)pyrrolo[3,2-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cn(-c2ccc3c(cc(-c4nc5n(n4)CCCC5c4ccc(F)cc4C)n3COCC[Si](C)(C)C)n2)cn1 |
| InChI | InChI=1S/C30H36FN7OSi/c1-20-15-22(31)8-9-23(20)24-7-6-12-38-30(24)34-29(35-38)27-16-25-26(37(27)19-39-13-14-40(3,4)5)10-11-28(33-25)36-17-21(2)32-18-36/h8-11,15-18,24H,6-7,12-14,19H2,1-5H3 |
| InChIKey | VBICEWYBHINFEN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|