C20H30O2 — CID 90181155
4,7-ditert-butylspiro[1,3-benzodioxole-2,1'-cyclohexane] (PubChem CID 90181155) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 4,7-ditert-butylspiro[1,3-benzodioxole-2,1'-cyclohexane].
| Compound Name | 4,7-ditert-butylspiro[1,3-benzodioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 90181155 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 4,7-ditert-butylspiro[1,3-benzodioxole-2,1'-cyclohexane] |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c2c1OC1(CCCCC1)O2 |
| InChI | InChI=1S/C20H30O2/c1-18(2,3)14-10-11-15(19(4,5)6)17-16(14)21-20(22-17)12-8-7-9-13-20/h10-11H,7-9,12-13H2,1-6H3 |
| InChIKey | FWPKFQKAMFVSHQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |