C21H28O2 — CID 90181189
4',7'-ditert-butylspiro[cyclopentane-1,2'-indene]-1',3'-dione (PubChem CID 90181189) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 4',7'-ditert-butylspiro[cyclopentane-1,2'-indene]-1',3'-dione.
| Compound Name | 4',7'-ditert-butylspiro[cyclopentane-1,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 90181189 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 4',7'-ditert-butylspiro[cyclopentane-1,2'-indene]-1',3'-dione |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c2c1C(=O)C1(CCCC1)C2=O |
| InChI | InChI=1S/C21H28O2/c1-19(2,3)13-9-10-14(20(4,5)6)16-15(13)17(22)21(18(16)23)11-7-8-12-21/h9-10H,7-8,11-12H2,1-6H3 |
| InChIKey | IOYALGRIZQTYNA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|