C11H21F2N — CID 90181204
1-tert-butyl-4,4-difluoro-2-propan-2-ylpyrrolidine (PubChem CID 90181204) has the molecular formula C11H21F2N and a molecular weight of 205.29 g/mol. Its IUPAC name is 1-tert-butyl-4,4-difluoro-2-propan-2-ylpyrrolidine.
| Compound Name | 1-tert-butyl-4,4-difluoro-2-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 90181204 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-tert-butyl-4,4-difluoro-2-propan-2-ylpyrrolidine |
| SMILES | CC(C)C1CC(F)(F)CN1C(C)(C)C |
| InChI | InChI=1S/C11H21F2N/c1-8(2)9-6-11(12,13)7-14(9)10(3,4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | JDRISYCSCSBTKI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |