C24H21F3N4O2S — CID 90181744
5-(benzenesulfinyl)-8,11-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 90181744) has the molecular formula C24H21F3N4O2S and a molecular weight of 486.52 g/mol. Its IUPAC name is 5-(benzenesulfinyl)-8,11-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | 5-(benzenesulfinyl)-8,11-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 90181744 |
| Molecular Formula | C24H21F3N4O2S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 5-(benzenesulfinyl)-8,11-dimethyl-4-[[4-(trifluoromethyl)phenyl]methyl]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CC1CN2C(=N1)N(C)C(=O)c1c2cn(Cc2ccc(C(F)(F)F)cc2)c1S(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21F3N4O2S/c1-15-12-31-19-14-30(13-16-8-10-17(11-9-16)24(25,26)27)22(34(33)18-6-4-3-5-7-18)20(19)21(32)29(2)23(31)28-15/h3-11,14-15H,12-13H2,1-2H3 |
| InChIKey | VPQRXKRHQWAFJI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |