C18H31N2O8P — CID 90181993
[1-[(1R,2R,3S,4R)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]-2-methylbutan-2-yl]oxy-[(2R)-2-hydroxybutan-2-yl]phosphinic acid (PubChem CID 90181993) has the molecular formula C18H31N2O8P and a molecular weight of 434.43 g/mol. Its IUPAC name is [1-[(1R,2R,3S,4R)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]-2-methylbutan-2-yl]oxy-[(2R)-2-hydroxybutan-2-yl]phosphinic acid.
| Compound Name | [1-[(1R,2R,3S,4R)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]-2-methylbutan-2-yl]oxy-[(2R)-2-hydroxybutan-2-yl]phosphinic acid |
|---|---|
| PubChem CID | 90181993 |
| Molecular Formula | C18H31N2O8P |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [1-[(1R,2R,3S,4R)-4-(2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]-2-methylbutan-2-yl]oxy-[(2R)-2-hydroxybutan-2-yl]phosphinic acid |
| SMILES | CCC(C)(C[C@H]1C[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)OP(=O)(O)[C@@](C)(O)CC |
| InChI | InChI=1S/C18H31N2O8P/c1-5-17(3,28-29(26,27)18(4,25)6-2)10-11-9-12(15(23)14(11)22)20-8-7-13(21)19-16(20)24/h7-8,11-12,14-15,22-23,25H,5-6,9-10H2,1-4H3,(H,26,27)(H,19,21,24)/t11-,12-,14-,15+,17?,18-/m1/s1 |
| InChIKey | GDYPWUVFSICGIG-QKSLDLRVSA-N |
| XLogP | 0.70 |
| TPSA | 162.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|