C23H20F2N2O — CID 90181998
9-(2,6-difluorophenyl)-N,2,7-trimethyl-6-methyliminoxanthen-3-amine (PubChem CID 90181998) has the molecular formula C23H20F2N2O and a molecular weight of 378.42 g/mol. Its IUPAC name is 9-(2,6-difluorophenyl)-N,2,7-trimethyl-6-methyliminoxanthen-3-amine.
| Compound Name | 9-(2,6-difluorophenyl)-N,2,7-trimethyl-6-methyliminoxanthen-3-amine |
|---|---|
| PubChem CID | 90181998 |
| Molecular Formula | C23H20F2N2O |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 9-(2,6-difluorophenyl)-N,2,7-trimethyl-6-methyliminoxanthen-3-amine |
| SMILES | C/N=c1\cc2oc3cc(NC)c(C)cc3c(-c3c(F)cccc3F)c-2cc1C |
| InChI | InChI=1S/C23H20F2N2O/c1-12-8-14-20(10-18(12)26-3)28-21-11-19(27-4)13(2)9-15(21)22(14)23-16(24)6-5-7-17(23)25/h5-11,26H,1-4H3/b27-19+ |
| InChIKey | PVHVOMWYRSJXHC-ZXVVBBHZSA-N |
| XLogP | 5.67 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|