C13H21NO5 — CID 90182501
[(6E)-8-methoxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N,N-dimethylcarbamate (PubChem CID 90182501) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is [(6E)-8-methoxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N,N-dimethylcarbamate.
| Compound Name | [(6E)-8-methoxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 90182501 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | [(6E)-8-methoxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N,N-dimethylcarbamate |
| SMILES | COC1/C=C\C(OC(=O)N(C)C)CC2OCOC2C1 |
| InChI | InChI=1S/C13H21NO5/c1-14(2)13(15)19-10-5-4-9(16-3)6-11-12(7-10)18-8-17-11/h4-5,9-12H,6-8H2,1-3H3/b5-4- |
| InChIKey | TZBLXFGPFYSIRJ-PLNGDYQASA-N |
| XLogP | 1.16 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|