C14H20O8 — CID 90182502
[(6E)-5-ethoxycarbonyloxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-8-yl] methyl carbonate (PubChem CID 90182502) has the molecular formula C14H20O8 and a molecular weight of 316.31 g/mol. Its IUPAC name is [(6E)-5-ethoxycarbonyloxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-8-yl] methyl carbonate.
| Compound Name | [(6E)-5-ethoxycarbonyloxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-8-yl] methyl carbonate |
|---|---|
| PubChem CID | 90182502 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [(6E)-5-ethoxycarbonyloxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-8-yl] methyl carbonate |
| SMILES | CCOC(=O)OC1/C=C\C(OC(=O)OC)CC2OCOC2C1 |
| InChI | InChI=1S/C14H20O8/c1-3-18-14(16)22-10-5-4-9(21-13(15)17-2)6-11-12(7-10)20-8-19-11/h4-5,9-12H,3,6-8H2,1-2H3/b5-4- |
| InChIKey | CEZAIKVPFLUBDF-PLNGDYQASA-N |
| XLogP | 1.77 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|