About [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate
[(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate (PubChem CID 90182519) has the molecular formula C12H20N2O5
and a molecular weight of 272.30 g/mol. Its IUPAC name is [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate.
Molecular Properties
| Compound Name | [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate |
| PubChem CID | 90182519 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1/C=C\C(OC(=O)NC)CC(O)CC1 |
| InChI | InChI=1S/C12H20N2O5/c1-13-11(16)18-9-4-3-8(15)7-10(6-5-9)19-12(17)14-2/h5-6,8-10,15H,3-4,7H2,1-2H3,(H,13,16)(H,14,17)/b6-5- |
| InChIKey | PWDRYNVZBYLLTM-WAYWQWQTSA-N |
| XLogP | 0.54 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate?
The IUPAC name of [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate (CID 90182519) is [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate.
What is the SMILES notation for [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate?
The canonical SMILES for [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate is CNC(=O)OC1/C=C\C(OC(=O)NC)CC(O)CC1.
What is the InChIKey of [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate?
The InChIKey is PWDRYNVZBYLLTM-WAYWQWQTSA-N. The full InChI is InChI=1S/C12H20N2O5/c1-13-11(16)18-9-4-3-8(15)7-10(6-5-9)19-12(17)14-2/h5-6,8-10,15H,3-4,7H2,1-2H3,(H,13,16)(H,14,17)/b6-5-.
What are the key properties of [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate?
[(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate has a molecular weight of 272.30 g/mol, XLogP of 0.54, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-6-hydroxy-4-(methylcarbamoyloxy)cyclooct-2-en-1-yl] N-methylcarbamate is sourced from PubChem (CID 90182519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).