C14H22N2O6 — CID 90182574
[(6E)-8-(methylcarbamoyloxy)-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-ethylcarbamate (PubChem CID 90182574) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is [(6E)-8-(methylcarbamoyloxy)-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-ethylcarbamate.
| Compound Name | [(6E)-8-(methylcarbamoyloxy)-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 90182574 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | [(6E)-8-(methylcarbamoyloxy)-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1/C=C\C(OC(=O)NC)CC2OCOC2C1 |
| InChI | InChI=1S/C14H22N2O6/c1-3-16-14(18)22-10-5-4-9(21-13(17)15-2)6-11-12(7-10)20-8-19-11/h4-5,9-12H,3,6-8H2,1-2H3,(H,15,17)(H,16,18)/b5-4- |
| InChIKey | XWWAQJNEHKEKFV-PLNGDYQASA-N |
| XLogP | 0.92 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|