C11H17NO5 — CID 90182584
[(6E)-8-hydroxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-methylcarbamate (PubChem CID 90182584) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is [(6E)-8-hydroxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-methylcarbamate.
| Compound Name | [(6E)-8-hydroxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 90182584 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | [(6E)-8-hydroxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1/C=C\C(O)CC2OCOC2C1 |
| InChI | InChI=1S/C11H17NO5/c1-12-11(14)17-8-3-2-7(13)4-9-10(5-8)16-6-15-9/h2-3,7-10,13H,4-6H2,1H3,(H,12,14)/b3-2- |
| InChIKey | PDRFSIJIZWAFCN-IHWYPQMZSA-N |
| XLogP | 0.16 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|