C11H16O6 — CID 90182598
[(6E)-8-hydroxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] methyl carbonate (PubChem CID 90182598) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is [(6E)-8-hydroxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] methyl carbonate.
| Compound Name | [(6E)-8-hydroxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] methyl carbonate |
|---|---|
| PubChem CID | 90182598 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | [(6E)-8-hydroxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] methyl carbonate |
| SMILES | COC(=O)OC1/C=C\C(O)CC2OCOC2C1 |
| InChI | InChI=1S/C11H16O6/c1-14-11(13)17-8-3-2-7(12)4-9-10(5-8)16-6-15-9/h2-3,7-10,12H,4-6H2,1H3/b3-2- |
| InChIKey | LKIDTEIZQAIQCJ-IHWYPQMZSA-N |
| XLogP | 0.59 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|