C12H19NO5 — CID 90182610
[(6E)-8-methoxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-methylcarbamate (PubChem CID 90182610) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is [(6E)-8-methoxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-methylcarbamate.
| Compound Name | [(6E)-8-methoxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 90182610 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [(6E)-8-methoxy-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-5-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1/C=C\C(OC)CC2OCOC2C1 |
| InChI | InChI=1S/C12H19NO5/c1-13-12(14)18-9-4-3-8(15-2)5-10-11(6-9)17-7-16-10/h3-4,8-11H,5-7H2,1-2H3,(H,13,14)/b4-3- |
| InChIKey | RSWCNKCFHLWZBV-ARJAWSKDSA-N |
| XLogP | 0.82 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|