C22H28N4 — CID 90183122
(2Z)-1-[(4aE)-4-[(Z)-1-(prop-2-enylideneamino)prop-1-enyl]-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazin-1-yl]-N-methylpenta-2,4-dien-1-imine (PubChem CID 90183122) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is (2Z)-1-[(4aE)-4-[(Z)-1-(prop-2-enylideneamino)prop-1-enyl]-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazin-1-yl]-N-methylpenta-2,4-dien-1-imine.
| Compound Name | (2Z)-1-[(4aE)-4-[(Z)-1-(prop-2-enylideneamino)prop-1-enyl]-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazin-1-yl]-N-methylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 90183122 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (2Z)-1-[(4aE)-4-[(Z)-1-(prop-2-enylideneamino)prop-1-enyl]-6,7,8,9,10,10a-hexahydrocycloocta[d]pyridazin-1-yl]-N-methylpenta-2,4-dien-1-imine |
| SMILES | C=C/C=C\C(=N/C)C1=NN=C(C(=C/C)/N=C/C=C)/C2=C/CCCCCC12 |
| InChI | InChI=1S/C22H28N4/c1-5-8-15-20(23-4)22-18-14-12-10-9-11-13-17(18)21(25-26-22)19(7-3)24-16-6-2/h5-8,13,15-16,18H,1-2,9-12,14H2,3-4H3/b15-8-,17-13+,19-7-,23-20+,24-16+ |
| InChIKey | YISAKGPDIHLQCS-PEZJKZOSSA-N |
| XLogP | 5.28 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|